C23H32N2O2 — CID 3876367
1-(5-butan-2-yl-2-phenylmethoxyphenyl)-2-piperazin-1-ylethanol (PubChem CID 3876367) has the molecular formula C23H32N2O2 and a molecular weight of 368.52 g/mol. Its IUPAC name is 1-(5-butan-2-yl-2-phenylmethoxyphenyl)-2-piperazin-1-ylethanol.
| Compound Name | 1-(5-butan-2-yl-2-phenylmethoxyphenyl)-2-piperazin-1-ylethanol |
|---|---|
| PubChem CID | 3876367 |
| Molecular Formula | C23H32N2O2 |
| Molecular Weight | 368.52 g/mol |
| Exact Mass | 368.25 |
| IUPAC Name | 1-(5-butan-2-yl-2-phenylmethoxyphenyl)-2-piperazin-1-ylethanol |
| SMILES | CCC(C)c1ccc(OCc2ccccc2)c(C(O)CN2CCNCC2)c1 |
| InChI | InChI=1S/C23H32N2O2/c1-3-18(2)20-9-10-23(27-17-19-7-5-4-6-8-19)21(15-20)22(26)16-25-13-11-24-12-14-25/h4-10,15,18,22,24,26H,3,11-14,16-17H2,1-2H3 |
| InChIKey | KWWRVZYCSXKCGA-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.52 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |