C45H40Br2O5 — CID 67818088
methyl 3,6-bis(5-bromo-2-phenylmethoxyphenyl)-4-hydroxy-3,6-diphenylhexanoate (PubChem CID 67818088) has the molecular formula C45H40Br2O5 and a molecular weight of 820.62 g/mol. Its IUPAC name is methyl 3,6-bis(5-bromo-2-phenylmethoxyphenyl)-4-hydroxy-3,6-diphenylhexanoate.
| Compound Name | methyl 3,6-bis(5-bromo-2-phenylmethoxyphenyl)-4-hydroxy-3,6-diphenylhexanoate |
|---|---|
| PubChem CID | 67818088 |
| Molecular Formula | C45H40Br2O5 |
| Molecular Weight | 820.62 g/mol |
| Exact Mass | 818.12 |
| IUPAC Name | methyl 3,6-bis(5-bromo-2-phenylmethoxyphenyl)-4-hydroxy-3,6-diphenylhexanoate |
| SMILES | COC(=O)CC(c1ccccc1)(c1cc(Br)ccc1OCc1ccccc1)C(O)CC(c1ccccc1)c1cc(Br)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C45H40Br2O5/c1-50-44(49)29-45(35-20-12-5-13-21-35,40-27-37(47)23-25-42(40)52-31-33-16-8-3-9-17-33)43(48)28-38(34-18-10-4-11-19-34)39-26-36(46)22-24-41(39)51-30-32-14-6-2-7-15-32/h2-27,38,43,48H,28-31H2,1H3 |
| InChIKey | KDUSXJCOVCIEDU-UHFFFAOYSA-N |
| XLogP | 10.80 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 820.62 |
| LogP ≤ 5 | 10.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |