C15H16BrNO4 — CID 118336542
2-(3-butoxy-4-methoxyphenyl)-1,3-oxazole-4-carbonyl bromide (PubChem CID 118336542) has the molecular formula C15H16BrNO4 and a molecular weight of 354.20 g/mol. Its IUPAC name is 2-(3-butoxy-4-methoxyphenyl)-1,3-oxazole-4-carbonyl bromide.
| Compound Name | 2-(3-butoxy-4-methoxyphenyl)-1,3-oxazole-4-carbonyl bromide |
|---|---|
| PubChem CID | 118336542 |
| Molecular Formula | C15H16BrNO4 |
| Molecular Weight | 354.20 g/mol |
| Exact Mass | 353.03 |
| IUPAC Name | 2-(3-butoxy-4-methoxyphenyl)-1,3-oxazole-4-carbonyl bromide |
| SMILES | CCCCOc1cc(-c2nc(C(=O)Br)co2)ccc1OC |
| InChI | InChI=1S/C15H16BrNO4/c1-3-4-7-20-13-8-10(5-6-12(13)19-2)15-17-11(9-21-15)14(16)18/h5-6,8-9H,3-4,7H2,1-2H3 |
| InChIKey | LNKFBYZQZAYVNA-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 61.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.20 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|