C23H25F2N3O4 — CID 144949424
5-(aminomethyl)-2-(3-butoxy-4-methoxyphenyl)-N-[(2,4-difluorophenyl)methyl]-1,3-oxazole-4-carboxamide (PubChem CID 144949424) has the molecular formula C23H25F2N3O4 and a molecular weight of 445.47 g/mol. Its IUPAC name is 5-(aminomethyl)-2-(3-butoxy-4-methoxyphenyl)-N-[(2,4-difluorophenyl)methyl]-1,3-oxazole-4-carboxamide.
| Compound Name | 5-(aminomethyl)-2-(3-butoxy-4-methoxyphenyl)-N-[(2,4-difluorophenyl)methyl]-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 144949424 |
| Molecular Formula | C23H25F2N3O4 |
| Molecular Weight | 445.47 g/mol |
| Exact Mass | 445.18 |
| IUPAC Name | 5-(aminomethyl)-2-(3-butoxy-4-methoxyphenyl)-N-[(2,4-difluorophenyl)methyl]-1,3-oxazole-4-carboxamide |
| SMILES | CCCCOc1cc(-c2nc(C(=O)NCc3ccc(F)cc3F)c(CN)o2)ccc1OC |
| InChI | InChI=1S/C23H25F2N3O4/c1-3-4-9-31-19-10-14(6-8-18(19)30-2)23-28-21(20(12-26)32-23)22(29)27-13-15-5-7-16(24)11-17(15)25/h5-8,10-11H,3-4,9,12-13,26H2,1-2H3,(H,27,29) |
| InChIKey | QOBLGCNANVSGBE-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 99.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.47 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|