C33H39F4N3O9 — CID 174981489
methyl 5-[2-(difluoromethoxy)-5-[4-[(2,4-difluorophenyl)methylcarbamoyl]-5-[1-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]-1,3-oxazol-2-yl]phenoxy]-2-ethylpentaneperoxoate (PubChem CID 174981489) has the molecular formula C33H39F4N3O9 and a molecular weight of 697.68 g/mol. Its IUPAC name is methyl 5-[2-(difluoromethoxy)-5-[4-[(2,4-difluorophenyl)methylcarbamoyl]-5-[1-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]-1,3-oxazol-2-yl]phenoxy]-2-ethylpentaneperoxoate.
| Compound Name | methyl 5-[2-(difluoromethoxy)-5-[4-[(2,4-difluorophenyl)methylcarbamoyl]-5-[1-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]-1,3-oxazol-2-yl]phenoxy]-2-ethylpentaneperoxoate |
|---|---|
| PubChem CID | 174981489 |
| Molecular Formula | C33H39F4N3O9 |
| Molecular Weight | 697.68 g/mol |
| Exact Mass | 697.26 |
| IUPAC Name | methyl 5-[2-(difluoromethoxy)-5-[4-[(2,4-difluorophenyl)methylcarbamoyl]-5-[1-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]-1,3-oxazol-2-yl]phenoxy]-2-ethylpentaneperoxoate |
| SMILES | CCC(CCCOc1cc(-c2nc(C(=O)NCc3ccc(F)cc3F)c(C(C)NC(=O)OC(C)(C)C)o2)ccc1OC(F)F)C(=O)OOC |
| InChI | InChI=1S/C33H39F4N3O9/c1-7-19(30(42)49-44-6)9-8-14-45-25-15-20(11-13-24(25)46-31(36)37)29-40-26(27(47-29)18(2)39-32(43)48-33(3,4)5)28(41)38-17-21-10-12-22(34)16-23(21)35/h10-13,15-16,18-19,31H,7-9,14,17H2,1-6H3,(H,38,41)(H,39,43) |
| InChIKey | CKSWIKBTLFEXSC-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 147.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.68 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|