C18H25N2O6+ — CID 136951760
methyl 2-(4,5-dibutoxy-1-hydroxypyridin-1-ium-2-yl)-1,3-oxazole-4-carboxylate (PubChem CID 136951760) has the molecular formula C18H25N2O6+ and a molecular weight of 365.41 g/mol. Its IUPAC name is methyl 2-(4,5-dibutoxy-1-hydroxypyridin-1-ium-2-yl)-1,3-oxazole-4-carboxylate.
| Compound Name | methyl 2-(4,5-dibutoxy-1-hydroxypyridin-1-ium-2-yl)-1,3-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 136951760 |
| Molecular Formula | C18H25N2O6+ |
| Molecular Weight | 365.41 g/mol |
| Exact Mass | 365.17 |
| IUPAC Name | methyl 2-(4,5-dibutoxy-1-hydroxypyridin-1-ium-2-yl)-1,3-oxazole-4-carboxylate |
| SMILES | CCCCOc1cc(-c2nc(C(=O)OC)co2)[n+](O)cc1OCCCC |
| InChI | InChI=1S/C18H25N2O6/c1-4-6-8-24-15-10-14(17-19-13(12-26-17)18(21)23-3)20(22)11-16(15)25-9-7-5-2/h10-12,22H,4-9H2,1-3H3/q+1 |
| InChIKey | UHIVGWGUXIFGSW-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 94.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.41 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|