C20H18Cl2N2O4 — CID 84552982
2-(3,4-dichlorophenyl)-N-(3,4-diethoxyphenyl)-1,3-oxazole-4-carboxamide (PubChem CID 84552982) has the molecular formula C20H18Cl2N2O4 and a molecular weight of 421.28 g/mol. Its IUPAC name is 2-(3,4-dichlorophenyl)-N-(3,4-diethoxyphenyl)-1,3-oxazole-4-carboxamide.
| Compound Name | 2-(3,4-dichlorophenyl)-N-(3,4-diethoxyphenyl)-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 84552982 |
| Molecular Formula | C20H18Cl2N2O4 |
| Molecular Weight | 421.28 g/mol |
| Exact Mass | 420.06 |
| IUPAC Name | 2-(3,4-dichlorophenyl)-N-(3,4-diethoxyphenyl)-1,3-oxazole-4-carboxamide |
| SMILES | CCOc1ccc(NC(=O)c2coc(-c3ccc(Cl)c(Cl)c3)n2)cc1OCC |
| InChI | InChI=1S/C20H18Cl2N2O4/c1-3-26-17-8-6-13(10-18(17)27-4-2)23-19(25)16-11-28-20(24-16)12-5-7-14(21)15(22)9-12/h5-11H,3-4H2,1-2H3,(H,23,25) |
| InChIKey | SGVRKHRBEZICLY-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 73.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.28 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |