C16H8Cl2FN3O4 — CID 84553164
2-(3,4-dichlorophenyl)-N-(3-fluoro-4-nitrophenyl)-1,3-oxazole-4-carboxamide (PubChem CID 84553164) has the molecular formula C16H8Cl2FN3O4 and a molecular weight of 396.16 g/mol. Its IUPAC name is 2-(3,4-dichlorophenyl)-N-(3-fluoro-4-nitrophenyl)-1,3-oxazole-4-carboxamide.
| Compound Name | 2-(3,4-dichlorophenyl)-N-(3-fluoro-4-nitrophenyl)-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 84553164 |
| Molecular Formula | C16H8Cl2FN3O4 |
| Molecular Weight | 396.16 g/mol |
| Exact Mass | 394.99 |
| IUPAC Name | 2-(3,4-dichlorophenyl)-N-(3-fluoro-4-nitrophenyl)-1,3-oxazole-4-carboxamide |
| SMILES | O=C(Nc1ccc([N+](=O)[O-])c(F)c1)c1coc(-c2ccc(Cl)c(Cl)c2)n1 |
| InChI | InChI=1S/C16H8Cl2FN3O4/c17-10-3-1-8(5-11(10)18)16-21-13(7-26-16)15(23)20-9-2-4-14(22(24)25)12(19)6-9/h1-7H,(H,20,23) |
| InChIKey | YERQXJLJOLBHMA-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 98.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.16 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|