C12H6Cl2FN3O3 — CID 114918756
2,5-dichloro-N-(3-fluoro-4-nitrophenyl)pyridine-4-carboxamide (PubChem CID 114918756) has the molecular formula C12H6Cl2FN3O3 and a molecular weight of 330.10 g/mol. Its IUPAC name is 2,5-dichloro-N-(3-fluoro-4-nitrophenyl)pyridine-4-carboxamide.
| Compound Name | 2,5-dichloro-N-(3-fluoro-4-nitrophenyl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 114918756 |
| Molecular Formula | C12H6Cl2FN3O3 |
| Molecular Weight | 330.10 g/mol |
| Exact Mass | 328.98 |
| IUPAC Name | 2,5-dichloro-N-(3-fluoro-4-nitrophenyl)pyridine-4-carboxamide |
| SMILES | O=C(Nc1ccc([N+](=O)[O-])c(F)c1)c1cc(Cl)ncc1Cl |
| InChI | InChI=1S/C12H6Cl2FN3O3/c13-8-5-16-11(14)4-7(8)12(19)17-6-1-2-10(18(20)21)9(15)3-6/h1-5H,(H,17,19) |
| InChIKey | MNDNJLTZGHEDHE-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 85.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.10 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|