C13H14N2O4 — CID 106485684
ethyl 2-[4-(aminomethyl)phenoxy]-1,3-oxazole-4-carboxylate (PubChem CID 106485684) has the molecular formula C13H14N2O4 and a molecular weight of 262.26 g/mol. Its IUPAC name is ethyl 2-[4-(aminomethyl)phenoxy]-1,3-oxazole-4-carboxylate.
| Compound Name | ethyl 2-[4-(aminomethyl)phenoxy]-1,3-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 106485684 |
| Molecular Formula | C13H14N2O4 |
| Molecular Weight | 262.26 g/mol |
| Exact Mass | 262.10 |
| IUPAC Name | ethyl 2-[4-(aminomethyl)phenoxy]-1,3-oxazole-4-carboxylate |
| SMILES | CCOC(=O)c1coc(Oc2ccc(CN)cc2)n1 |
| InChI | InChI=1S/C13H14N2O4/c1-2-17-12(16)11-8-18-13(15-11)19-10-5-3-9(7-14)4-6-10/h3-6,8H,2,7,14H2,1H3 |
| InChIKey | KZFZYFWPWAYACT-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 87.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.26 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |