C11H19NO6 — CID 113427161
[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]-1,3-oxazol-4-yl]methanol (PubChem CID 113427161) has the molecular formula C11H19NO6 and a molecular weight of 261.27 g/mol. Its IUPAC name is [2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]-1,3-oxazol-4-yl]methanol.
| Compound Name | [2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]-1,3-oxazol-4-yl]methanol |
|---|---|
| PubChem CID | 113427161 |
| Molecular Formula | C11H19NO6 |
| Molecular Weight | 261.27 g/mol |
| Exact Mass | 261.12 |
| IUPAC Name | [2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]-1,3-oxazol-4-yl]methanol |
| SMILES | COCCOCCOCCOc1nc(CO)co1 |
| InChI | InChI=1S/C11H19NO6/c1-14-2-3-15-4-5-16-6-7-17-11-12-10(8-13)9-18-11/h9,13H,2-8H2,1H3 |
| InChIKey | NJQZDKIODPBZQO-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 83.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.27 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|