C21H25NO5 — CID 3375649
6-O-(4-heptoxyphenyl) 2-O-methyl pyridine-2,6-dicarboxylate (PubChem CID 3375649) has the molecular formula C21H25NO5 and a molecular weight of 371.43 g/mol. Its IUPAC name is 6-O-(4-heptoxyphenyl) 2-O-methyl pyridine-2,6-dicarboxylate.
| Compound Name | 6-O-(4-heptoxyphenyl) 2-O-methyl pyridine-2,6-dicarboxylate |
|---|---|
| PubChem CID | 3375649 |
| Molecular Formula | C21H25NO5 |
| Molecular Weight | 371.43 g/mol |
| Exact Mass | 371.17 |
| IUPAC Name | 6-O-(4-heptoxyphenyl) 2-O-methyl pyridine-2,6-dicarboxylate |
| SMILES | CCCCCCCOc1ccc(OC(=O)c2cccc(C(=O)OC)n2)cc1 |
| InChI | InChI=1S/C21H25NO5/c1-3-4-5-6-7-15-26-16-11-13-17(14-12-16)27-21(24)19-10-8-9-18(22-19)20(23)25-2/h8-14H,3-7,15H2,1-2H3 |
| InChIKey | MGSXVJDYPNSKBH-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 74.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.43 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|