C17H20N2O3Si — CID 166350628
methyl 2-[[2-(2-trimethylsilylethynyl)anilino]methyl]-1,3-oxazole-4-carboxylate (PubChem CID 166350628) has the molecular formula C17H20N2O3Si and a molecular weight of 328.44 g/mol. Its IUPAC name is methyl 2-[[2-(2-trimethylsilylethynyl)anilino]methyl]-1,3-oxazole-4-carboxylate.
| Compound Name | methyl 2-[[2-(2-trimethylsilylethynyl)anilino]methyl]-1,3-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 166350628 |
| Molecular Formula | C17H20N2O3Si |
| Molecular Weight | 328.44 g/mol |
| Exact Mass | 328.12 |
| IUPAC Name | methyl 2-[[2-(2-trimethylsilylethynyl)anilino]methyl]-1,3-oxazole-4-carboxylate |
| SMILES | COC(=O)c1coc(CNc2ccccc2C#C[Si](C)(C)C)n1 |
| InChI | InChI=1S/C17H20N2O3Si/c1-21-17(20)15-12-22-16(19-15)11-18-14-8-6-5-7-13(14)9-10-23(2,3)4/h5-8,12,18H,11H2,1-4H3 |
| InChIKey | IPPHKBJUYYRQQS-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.44 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|