C15H11NO5 — CID 166431194
methyl 7-(5-formylfuran-2-yl)-2-methyl-1,3-benzoxazole-5-carboxylate (PubChem CID 166431194) has the molecular formula C15H11NO5 and a molecular weight of 285.25 g/mol. Its IUPAC name is methyl 7-(5-formylfuran-2-yl)-2-methyl-1,3-benzoxazole-5-carboxylate.
| Compound Name | methyl 7-(5-formylfuran-2-yl)-2-methyl-1,3-benzoxazole-5-carboxylate |
|---|---|
| PubChem CID | 166431194 |
| Molecular Formula | C15H11NO5 |
| Molecular Weight | 285.25 g/mol |
| Exact Mass | 285.06 |
| IUPAC Name | methyl 7-(5-formylfuran-2-yl)-2-methyl-1,3-benzoxazole-5-carboxylate |
| SMILES | COC(=O)c1cc(-c2ccc(C=O)o2)c2oc(C)nc2c1 |
| InChI | InChI=1S/C15H11NO5/c1-8-16-12-6-9(15(18)19-2)5-11(14(12)20-8)13-4-3-10(7-17)21-13/h3-7H,1-2H3 |
| InChIKey | KLASCDUHBNEWDO-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 82.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.25 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|