C17H20N4O3 — CID 168543867
3-(2,2-dicyanoethenylamino)-N,N-diethyl-4,5-dimethoxybenzamide (PubChem CID 168543867) has the molecular formula C17H20N4O3 and a molecular weight of 328.37 g/mol. Its IUPAC name is 3-(2,2-dicyanoethenylamino)-N,N-diethyl-4,5-dimethoxybenzamide.
| Compound Name | 3-(2,2-dicyanoethenylamino)-N,N-diethyl-4,5-dimethoxybenzamide |
|---|---|
| PubChem CID | 168543867 |
| Molecular Formula | C17H20N4O3 |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.15 |
| IUPAC Name | 3-(2,2-dicyanoethenylamino)-N,N-diethyl-4,5-dimethoxybenzamide |
| SMILES | CCN(CC)C(=O)c1cc(NC=C(C#N)C#N)c(OC)c(OC)c1 |
| InChI | InChI=1S/C17H20N4O3/c1-5-21(6-2)17(22)13-7-14(20-11-12(9-18)10-19)16(24-4)15(8-13)23-3/h7-8,11,20H,5-6H2,1-4H3 |
| InChIKey | FEBGJLWKIHXTFO-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 98.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|