C21H22N2O5 — CID 168518416
3-(1,3-dioxoisoindol-2-yl)-N,N-diethyl-4,5-dimethoxybenzamide (PubChem CID 168518416) has the molecular formula C21H22N2O5 and a molecular weight of 382.42 g/mol. Its IUPAC name is 3-(1,3-dioxoisoindol-2-yl)-N,N-diethyl-4,5-dimethoxybenzamide.
| Compound Name | 3-(1,3-dioxoisoindol-2-yl)-N,N-diethyl-4,5-dimethoxybenzamide |
|---|---|
| PubChem CID | 168518416 |
| Molecular Formula | C21H22N2O5 |
| Molecular Weight | 382.42 g/mol |
| Exact Mass | 382.15 |
| IUPAC Name | 3-(1,3-dioxoisoindol-2-yl)-N,N-diethyl-4,5-dimethoxybenzamide |
| SMILES | CCN(CC)C(=O)c1cc(OC)c(OC)c(N2C(=O)c3ccccc3C2=O)c1 |
| InChI | InChI=1S/C21H22N2O5/c1-5-22(6-2)19(24)13-11-16(18(28-4)17(12-13)27-3)23-20(25)14-9-7-8-10-15(14)21(23)26/h7-12H,5-6H2,1-4H3 |
| InChIKey | USWDFSRUODCIRL-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.42 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|