C22H16INO6S — CID 11584787
2-[5-iodo-3-(3,4,5-trimethoxybenzoyl)thiophen-2-yl]isoindole-1,3-dione (PubChem CID 11584787) has the molecular formula C22H16INO6S and a molecular weight of 549.34 g/mol. Its IUPAC name is 2-[5-iodo-3-(3,4,5-trimethoxybenzoyl)thiophen-2-yl]isoindole-1,3-dione.
| Compound Name | 2-[5-iodo-3-(3,4,5-trimethoxybenzoyl)thiophen-2-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 11584787 |
| Molecular Formula | C22H16INO6S |
| Molecular Weight | 549.34 g/mol |
| Exact Mass | 548.97 |
| IUPAC Name | 2-[5-iodo-3-(3,4,5-trimethoxybenzoyl)thiophen-2-yl]isoindole-1,3-dione |
| SMILES | COc1cc(C(=O)c2cc(I)sc2N2C(=O)c3ccccc3C2=O)cc(OC)c1OC |
| InChI | InChI=1S/C22H16INO6S/c1-28-15-8-11(9-16(29-2)19(15)30-3)18(25)14-10-17(23)31-22(14)24-20(26)12-6-4-5-7-13(12)21(24)27/h4-10H,1-3H3 |
| InChIKey | MGVPHZAWCRIBSY-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.34 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|