C15H16N4O — CID 17194664
3-(2,2-dicyanoethenylamino)-N,N-diethylbenzamide (PubChem CID 17194664) has the molecular formula C15H16N4O and a molecular weight of 268.32 g/mol. Its IUPAC name is 3-(2,2-dicyanoethenylamino)-N,N-diethylbenzamide.
| Compound Name | 3-(2,2-dicyanoethenylamino)-N,N-diethylbenzamide |
|---|---|
| PubChem CID | 17194664 |
| Molecular Formula | C15H16N4O |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | 3-(2,2-dicyanoethenylamino)-N,N-diethylbenzamide |
| SMILES | CCN(CC)C(=O)c1cccc(NC=C(C#N)C#N)c1 |
| InChI | InChI=1S/C15H16N4O/c1-3-19(4-2)15(20)13-6-5-7-14(8-13)18-11-12(9-16)10-17/h5-8,11,18H,3-4H2,1-2H3 |
| InChIKey | GWRNALUXNKWFTA-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 79.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|