C18H13N3O4 — CID 168545096
2-(2,2-dicyanoethenylamino)-5-(2-methoxyphenoxy)benzoic acid (PubChem CID 168545096) has the molecular formula C18H13N3O4 and a molecular weight of 335.32 g/mol. Its IUPAC name is 2-(2,2-dicyanoethenylamino)-5-(2-methoxyphenoxy)benzoic acid.
| Compound Name | 2-(2,2-dicyanoethenylamino)-5-(2-methoxyphenoxy)benzoic acid |
|---|---|
| PubChem CID | 168545096 |
| Molecular Formula | C18H13N3O4 |
| Molecular Weight | 335.32 g/mol |
| Exact Mass | 335.09 |
| IUPAC Name | 2-(2,2-dicyanoethenylamino)-5-(2-methoxyphenoxy)benzoic acid |
| SMILES | COc1ccccc1Oc1ccc(NC=C(C#N)C#N)c(C(=O)O)c1 |
| InChI | InChI=1S/C18H13N3O4/c1-24-16-4-2-3-5-17(16)25-13-6-7-15(14(8-13)18(22)23)21-11-12(9-19)10-20/h2-8,11,21H,1H3,(H,22,23) |
| InChIKey | BXEYXZYOZNUSEU-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 115.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.32 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|