C19H12N4O4 — CID 168610312
5-(2-methoxyphenoxy)-2-(1,2,2-tricyanoethenylamino)benzoic acid (PubChem CID 168610312) has the molecular formula C19H12N4O4 and a molecular weight of 360.33 g/mol. Its IUPAC name is 5-(2-methoxyphenoxy)-2-(1,2,2-tricyanoethenylamino)benzoic acid.
| Compound Name | 5-(2-methoxyphenoxy)-2-(1,2,2-tricyanoethenylamino)benzoic acid |
|---|---|
| PubChem CID | 168610312 |
| Molecular Formula | C19H12N4O4 |
| Molecular Weight | 360.33 g/mol |
| Exact Mass | 360.09 |
| IUPAC Name | 5-(2-methoxyphenoxy)-2-(1,2,2-tricyanoethenylamino)benzoic acid |
| SMILES | COc1ccccc1Oc1ccc(NC(C#N)=C(C#N)C#N)c(C(=O)O)c1 |
| InChI | InChI=1S/C19H12N4O4/c1-26-17-4-2-3-5-18(17)27-13-6-7-15(14(8-13)19(24)25)23-16(11-22)12(9-20)10-21/h2-8,23H,1H3,(H,24,25) |
| InChIKey | JYSIZMFLZDOUIP-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 139.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.33 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|