C15H12N4O4 — CID 168607787
methyl 2-[4-methoxy-3-(1,2,2-tricyanoethenylamino)phenoxy]acetate (PubChem CID 168607787) has the molecular formula C15H12N4O4 and a molecular weight of 312.29 g/mol. Its IUPAC name is methyl 2-[4-methoxy-3-(1,2,2-tricyanoethenylamino)phenoxy]acetate.
| Compound Name | methyl 2-[4-methoxy-3-(1,2,2-tricyanoethenylamino)phenoxy]acetate |
|---|---|
| PubChem CID | 168607787 |
| Molecular Formula | C15H12N4O4 |
| Molecular Weight | 312.29 g/mol |
| Exact Mass | 312.09 |
| IUPAC Name | methyl 2-[4-methoxy-3-(1,2,2-tricyanoethenylamino)phenoxy]acetate |
| SMILES | COC(=O)COc1ccc(OC)c(NC(C#N)=C(C#N)C#N)c1 |
| InChI | InChI=1S/C15H12N4O4/c1-21-14-4-3-11(23-9-15(20)22-2)5-12(14)19-13(8-18)10(6-16)7-17/h3-5,19H,9H2,1-2H3 |
| InChIKey | OVRYYZBYVKWBRE-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 128.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.29 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|