C12H12N4O3S — CID 168545331
N-[2-(2,2-dicyanoethenylamino)-4-methoxyphenyl]methanesulfonamide (PubChem CID 168545331) has the molecular formula C12H12N4O3S and a molecular weight of 292.32 g/mol. Its IUPAC name is N-[2-(2,2-dicyanoethenylamino)-4-methoxyphenyl]methanesulfonamide.
| Compound Name | N-[2-(2,2-dicyanoethenylamino)-4-methoxyphenyl]methanesulfonamide |
|---|---|
| PubChem CID | 168545331 |
| Molecular Formula | C12H12N4O3S |
| Molecular Weight | 292.32 g/mol |
| Exact Mass | 292.06 |
| IUPAC Name | N-[2-(2,2-dicyanoethenylamino)-4-methoxyphenyl]methanesulfonamide |
| SMILES | COc1ccc(NS(C)(=O)=O)c(NC=C(C#N)C#N)c1 |
| InChI | InChI=1S/C12H12N4O3S/c1-19-10-3-4-11(16-20(2,17)18)12(5-10)15-8-9(6-13)7-14/h3-5,8,15-16H,1-2H3 |
| InChIKey | ZFURJGQHAHCZIP-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 115.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.32 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|