C17H14N4O3S — CID 168543230
4-(2,2-dicyanoethenylamino)-N-(3-methoxyphenyl)benzenesulfonamide (PubChem CID 168543230) has the molecular formula C17H14N4O3S and a molecular weight of 354.39 g/mol. Its IUPAC name is 4-(2,2-dicyanoethenylamino)-N-(3-methoxyphenyl)benzenesulfonamide.
| Compound Name | 4-(2,2-dicyanoethenylamino)-N-(3-methoxyphenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 168543230 |
| Molecular Formula | C17H14N4O3S |
| Molecular Weight | 354.39 g/mol |
| Exact Mass | 354.08 |
| IUPAC Name | 4-(2,2-dicyanoethenylamino)-N-(3-methoxyphenyl)benzenesulfonamide |
| SMILES | COc1cccc(NS(=O)(=O)c2ccc(NC=C(C#N)C#N)cc2)c1 |
| InChI | InChI=1S/C17H14N4O3S/c1-24-16-4-2-3-15(9-16)21-25(22,23)17-7-5-14(6-8-17)20-12-13(10-18)11-19/h2-9,12,20-21H,1H3 |
| InChIKey | WMUNQDSKOJZVFH-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 115.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.39 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|