C14H8N4O2 — CID 168545126
5-(2,2-dicyanoethenylamino)quinoline-3-carboxylic acid (PubChem CID 168545126) has the molecular formula C14H8N4O2 and a molecular weight of 264.24 g/mol. Its IUPAC name is 5-(2,2-dicyanoethenylamino)quinoline-3-carboxylic acid.
| Compound Name | 5-(2,2-dicyanoethenylamino)quinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 168545126 |
| Molecular Formula | C14H8N4O2 |
| Molecular Weight | 264.24 g/mol |
| Exact Mass | 264.06 |
| IUPAC Name | 5-(2,2-dicyanoethenylamino)quinoline-3-carboxylic acid |
| SMILES | N#CC(C#N)=CNc1cccc2ncc(C(=O)O)cc12 |
| InChI | InChI=1S/C14H8N4O2/c15-5-9(6-16)7-17-12-2-1-3-13-11(12)4-10(8-18-13)14(19)20/h1-4,7-8,17H,(H,19,20) |
| InChIKey | XTSJTMWNIHYUOK-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 109.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.24 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|