5-(2,2-dicyanoethenylamino)quinoline-3-carboxylic acid

C14H8N4O2 — CID 168545126

IUPAC5-(2,2-dicyanoethenylamino)quinoline-3-carboxylic acid
SMILESN#CC(C#N)=CNc1cccc2ncc(C(=O)O)cc12
InChIInChI=1S/C14H8N4O2/c15-5-9(6-16)7-17-12-2-1-3-13-11(12)4-10(8-18-13)14(19)20/h1-4,7-8,17H,(H,19,20)
InChIKeyXTSJTMWNIHYUOK-UHFFFAOYSA-N
MW264.24 g/mol
LogP2.28
Rot. Bonds3

About 5-(2,2-dicyanoethenylamino)quinoline-3-carboxylic acid

5-(2,2-dicyanoethenylamino)quinoline-3-carboxylic acid (PubChem CID 168545126) has the molecular formula C14H8N4O2 and a molecular weight of 264.24 g/mol. Its IUPAC name is 5-(2,2-dicyanoethenylamino)quinoline-3-carboxylic acid.

Molecular Properties

Compound Name5-(2,2-dicyanoethenylamino)quinoline-3-carboxylic acid
PubChem CID168545126
Molecular FormulaC14H8N4O2
Molecular Weight264.24 g/mol
Exact Mass264.06
IUPAC Name5-(2,2-dicyanoethenylamino)quinoline-3-carboxylic acid
SMILESN#CC(C#N)=CNc1cccc2ncc(C(=O)O)cc12
InChIInChI=1S/C14H8N4O2/c15-5-9(6-16)7-17-12-2-1-3-13-11(12)4-10(8-18-13)14(19)20/h1-4,7-8,17H,(H,19,20)
InChIKeyXTSJTMWNIHYUOK-UHFFFAOYSA-N
XLogP2.28
TPSA109.80 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms20
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500264.24
LogP ≤ 52.28
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}

Analyze 5-(2,2-dicyanoethenylamino)quinoline-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-(2,2-dicyanoethenylamino)quinoline-3-carboxylic acid?
The IUPAC name of 5-(2,2-dicyanoethenylamino)quinoline-3-carboxylic acid (CID 168545126) is 5-(2,2-dicyanoethenylamino)quinoline-3-carboxylic acid.
What is the SMILES notation for 5-(2,2-dicyanoethenylamino)quinoline-3-carboxylic acid?
The canonical SMILES for 5-(2,2-dicyanoethenylamino)quinoline-3-carboxylic acid is N#CC(C#N)=CNc1cccc2ncc(C(=O)O)cc12.
What is the InChIKey of 5-(2,2-dicyanoethenylamino)quinoline-3-carboxylic acid?
The InChIKey is XTSJTMWNIHYUOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H8N4O2/c15-5-9(6-16)7-17-12-2-1-3-13-11(12)4-10(8-18-13)14(19)20/h1-4,7-8,17H,(H,19,20).
What are the key properties of 5-(2,2-dicyanoethenylamino)quinoline-3-carboxylic acid?
5-(2,2-dicyanoethenylamino)quinoline-3-carboxylic acid has a molecular weight of 264.24 g/mol, XLogP of 2.28, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2,2-dicyanoethenylamino)quinoline-3-carboxylic acid is sourced from PubChem (CID 168545126), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).