C14H13N3O2 — CID 168542488
2-[4-(2,2-dicyanoethenylamino)phenyl]-2-methylpropanoic acid (PubChem CID 168542488) has the molecular formula C14H13N3O2 and a molecular weight of 255.28 g/mol. Its IUPAC name is 2-[4-(2,2-dicyanoethenylamino)phenyl]-2-methylpropanoic acid.
| Compound Name | 2-[4-(2,2-dicyanoethenylamino)phenyl]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 168542488 |
| Molecular Formula | C14H13N3O2 |
| Molecular Weight | 255.28 g/mol |
| Exact Mass | 255.10 |
| IUPAC Name | 2-[4-(2,2-dicyanoethenylamino)phenyl]-2-methylpropanoic acid |
| SMILES | CC(C)(C(=O)O)c1ccc(NC=C(C#N)C#N)cc1 |
| InChI | InChI=1S/C14H13N3O2/c1-14(2,13(18)19)11-3-5-12(6-4-11)17-9-10(7-15)8-16/h3-6,9,17H,1-2H3,(H,18,19) |
| InChIKey | JKCIJAOMEJZWPP-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 96.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.28 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|