C12H10N4O — CID 168545042
2-[4-(2,2-dicyanoethenylamino)phenyl]acetamide (PubChem CID 168545042) has the molecular formula C12H10N4O and a molecular weight of 226.24 g/mol. Its IUPAC name is 2-[4-(2,2-dicyanoethenylamino)phenyl]acetamide.
| Compound Name | 2-[4-(2,2-dicyanoethenylamino)phenyl]acetamide |
|---|---|
| PubChem CID | 168545042 |
| Molecular Formula | C12H10N4O |
| Molecular Weight | 226.24 g/mol |
| Exact Mass | 226.09 |
| IUPAC Name | 2-[4-(2,2-dicyanoethenylamino)phenyl]acetamide |
| SMILES | N#CC(C#N)=CNc1ccc(CC(N)=O)cc1 |
| InChI | InChI=1S/C12H10N4O/c13-6-10(7-14)8-16-11-3-1-9(2-4-11)5-12(15)17/h1-4,8,16H,5H2,(H2,15,17) |
| InChIKey | JESNIWSQAVVABQ-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 102.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.24 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|