C13H10F3N3O — CID 168543950
2-[[4-(2,2,2-trifluoroethoxymethyl)anilino]methylidene]propanedinitrile (PubChem CID 168543950) has the molecular formula C13H10F3N3O and a molecular weight of 281.24 g/mol. Its IUPAC name is 2-[[4-(2,2,2-trifluoroethoxymethyl)anilino]methylidene]propanedinitrile.
| Compound Name | 2-[[4-(2,2,2-trifluoroethoxymethyl)anilino]methylidene]propanedinitrile |
|---|---|
| PubChem CID | 168543950 |
| Molecular Formula | C13H10F3N3O |
| Molecular Weight | 281.24 g/mol |
| Exact Mass | 281.08 |
| IUPAC Name | 2-[[4-(2,2,2-trifluoroethoxymethyl)anilino]methylidene]propanedinitrile |
| SMILES | N#CC(C#N)=CNc1ccc(COCC(F)(F)F)cc1 |
| InChI | InChI=1S/C13H10F3N3O/c14-13(15,16)9-20-8-10-1-3-12(4-2-10)19-7-11(5-17)6-18/h1-4,7,19H,8-9H2 |
| InChIKey | KZTCTEGQFOEOPD-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 68.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.24 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|