C16H11N3O3 — CID 168542399
methyl 5-[4-(2,2-dicyanoethenylamino)phenyl]furan-2-carboxylate (PubChem CID 168542399) has the molecular formula C16H11N3O3 and a molecular weight of 293.28 g/mol. Its IUPAC name is methyl 5-[4-(2,2-dicyanoethenylamino)phenyl]furan-2-carboxylate.
| Compound Name | methyl 5-[4-(2,2-dicyanoethenylamino)phenyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 168542399 |
| Molecular Formula | C16H11N3O3 |
| Molecular Weight | 293.28 g/mol |
| Exact Mass | 293.08 |
| IUPAC Name | methyl 5-[4-(2,2-dicyanoethenylamino)phenyl]furan-2-carboxylate |
| SMILES | COC(=O)c1ccc(-c2ccc(NC=C(C#N)C#N)cc2)o1 |
| InChI | InChI=1S/C16H11N3O3/c1-21-16(20)15-7-6-14(22-15)12-2-4-13(5-3-12)19-10-11(8-17)9-18/h2-7,10,19H,1H3 |
| InChIKey | DOMXJVUZOPUJPD-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 99.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.28 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|