C14H11N5O2 — CID 168544733
methyl 5-(2,2-dicyanoethenylamino)-1-methylindazole-3-carboxylate (PubChem CID 168544733) has the molecular formula C14H11N5O2 and a molecular weight of 281.28 g/mol. Its IUPAC name is methyl 5-(2,2-dicyanoethenylamino)-1-methylindazole-3-carboxylate.
| Compound Name | methyl 5-(2,2-dicyanoethenylamino)-1-methylindazole-3-carboxylate |
|---|---|
| PubChem CID | 168544733 |
| Molecular Formula | C14H11N5O2 |
| Molecular Weight | 281.28 g/mol |
| Exact Mass | 281.09 |
| IUPAC Name | methyl 5-(2,2-dicyanoethenylamino)-1-methylindazole-3-carboxylate |
| SMILES | COC(=O)c1nn(C)c2ccc(NC=C(C#N)C#N)cc12 |
| InChI | InChI=1S/C14H11N5O2/c1-19-12-4-3-10(17-8-9(6-15)7-16)5-11(12)13(18-19)14(20)21-2/h3-5,8,17H,1-2H3 |
| InChIKey | CBSKIJFKBDDEKF-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 103.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.28 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|