C19H16N4O3 — CID 54350555
2-cyano-3-(5-methoxy-1-methylindazol-3-yl)-3-oxo-N-phenylpropanamide (PubChem CID 54350555) has the molecular formula C19H16N4O3 and a molecular weight of 348.36 g/mol. Its IUPAC name is 2-cyano-3-(5-methoxy-1-methylindazol-3-yl)-3-oxo-N-phenylpropanamide.
| Compound Name | 2-cyano-3-(5-methoxy-1-methylindazol-3-yl)-3-oxo-N-phenylpropanamide |
|---|---|
| PubChem CID | 54350555 |
| Molecular Formula | C19H16N4O3 |
| Molecular Weight | 348.36 g/mol |
| Exact Mass | 348.12 |
| IUPAC Name | 2-cyano-3-(5-methoxy-1-methylindazol-3-yl)-3-oxo-N-phenylpropanamide |
| SMILES | COc1ccc2c(c1)c(C(=O)C(C#N)C(=O)Nc1ccccc1)nn2C |
| InChI | InChI=1S/C19H16N4O3/c1-23-16-9-8-13(26-2)10-14(16)17(22-23)18(24)15(11-20)19(25)21-12-6-4-3-5-7-12/h3-10,15H,1-2H3,(H,21,25) |
| InChIKey | UFKQBLUAWMFAJR-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 97.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.36 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|