C16H13N3O3 — CID 168543539
2-[[4-[5-(hydroxymethyl)furan-2-yl]-3-methoxyanilino]methylidene]propanedinitrile (PubChem CID 168543539) has the molecular formula C16H13N3O3 and a molecular weight of 295.30 g/mol. Its IUPAC name is 2-[[4-[5-(hydroxymethyl)furan-2-yl]-3-methoxyanilino]methylidene]propanedinitrile.
| Compound Name | 2-[[4-[5-(hydroxymethyl)furan-2-yl]-3-methoxyanilino]methylidene]propanedinitrile |
|---|---|
| PubChem CID | 168543539 |
| Molecular Formula | C16H13N3O3 |
| Molecular Weight | 295.30 g/mol |
| Exact Mass | 295.10 |
| IUPAC Name | 2-[[4-[5-(hydroxymethyl)furan-2-yl]-3-methoxyanilino]methylidene]propanedinitrile |
| SMILES | COc1cc(NC=C(C#N)C#N)ccc1-c1ccc(CO)o1 |
| InChI | InChI=1S/C16H13N3O3/c1-21-16-6-12(19-9-11(7-17)8-18)2-4-14(16)15-5-3-13(10-20)22-15/h2-6,9,19-20H,10H2,1H3 |
| InChIKey | BYISTRDSVSMHGF-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 102.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.30 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|