C13H13NO4 — CID 168653185
N-[4-[5-(hydroxymethyl)furan-2-yl]-3-methoxyphenyl]formamide (PubChem CID 168653185) has the molecular formula C13H13NO4 and a molecular weight of 247.25 g/mol. Its IUPAC name is N-[4-[5-(hydroxymethyl)furan-2-yl]-3-methoxyphenyl]formamide.
| Compound Name | N-[4-[5-(hydroxymethyl)furan-2-yl]-3-methoxyphenyl]formamide |
|---|---|
| PubChem CID | 168653185 |
| Molecular Formula | C13H13NO4 |
| Molecular Weight | 247.25 g/mol |
| Exact Mass | 247.08 |
| IUPAC Name | N-[4-[5-(hydroxymethyl)furan-2-yl]-3-methoxyphenyl]formamide |
| SMILES | COc1cc(NC=O)ccc1-c1ccc(CO)o1 |
| InChI | InChI=1S/C13H13NO4/c1-17-13-6-9(14-8-16)2-4-11(13)12-5-3-10(7-15)18-12/h2-6,8,15H,7H2,1H3,(H,14,16) |
| InChIKey | KPLJUYMGDCCIEG-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 71.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.25 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|