C12H4N6O2 — CID 168545226
4-(2,2-dicyanoethenylamino)-5-nitrobenzene-1,2-dicarbonitrile (PubChem CID 168545226) has the molecular formula C12H4N6O2 and a molecular weight of 264.20 g/mol. Its IUPAC name is 4-(2,2-dicyanoethenylamino)-5-nitrobenzene-1,2-dicarbonitrile.
| Compound Name | 4-(2,2-dicyanoethenylamino)-5-nitrobenzene-1,2-dicarbonitrile |
|---|---|
| PubChem CID | 168545226 |
| Molecular Formula | C12H4N6O2 |
| Molecular Weight | 264.20 g/mol |
| Exact Mass | 264.04 |
| IUPAC Name | 4-(2,2-dicyanoethenylamino)-5-nitrobenzene-1,2-dicarbonitrile |
| SMILES | N#CC(C#N)=CNc1cc(C#N)c(C#N)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H4N6O2/c13-3-8(4-14)7-17-11-1-9(5-15)10(6-16)2-12(11)18(19)20/h1-2,7,17H |
| InChIKey | KOVWOBBNQKUJGB-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 150.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.20 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|