C18H14N4O3 — CID 168543167
2-[[3-(3,5-dimethylphenoxy)-5-nitroanilino]methylidene]propanedinitrile (PubChem CID 168543167) has the molecular formula C18H14N4O3 and a molecular weight of 334.34 g/mol. Its IUPAC name is 2-[[3-(3,5-dimethylphenoxy)-5-nitroanilino]methylidene]propanedinitrile.
| Compound Name | 2-[[3-(3,5-dimethylphenoxy)-5-nitroanilino]methylidene]propanedinitrile |
|---|---|
| PubChem CID | 168543167 |
| Molecular Formula | C18H14N4O3 |
| Molecular Weight | 334.34 g/mol |
| Exact Mass | 334.11 |
| IUPAC Name | 2-[[3-(3,5-dimethylphenoxy)-5-nitroanilino]methylidene]propanedinitrile |
| SMILES | Cc1cc(C)cc(Oc2cc(NC=C(C#N)C#N)cc([N+](=O)[O-])c2)c1 |
| InChI | InChI=1S/C18H14N4O3/c1-12-3-13(2)5-17(4-12)25-18-7-15(6-16(8-18)22(23)24)21-11-14(9-19)10-20/h3-8,11,21H,1-2H3 |
| InChIKey | BNWGLVFHYXCOKM-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 111.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.34 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|