C17H8ClN5O3 — CID 168608688
2-[3-(4-chlorophenoxy)-5-nitroanilino]ethene-1,1,2-tricarbonitrile (PubChem CID 168608688) has the molecular formula C17H8ClN5O3 and a molecular weight of 365.74 g/mol. Its IUPAC name is 2-[3-(4-chlorophenoxy)-5-nitroanilino]ethene-1,1,2-tricarbonitrile.
| Compound Name | 2-[3-(4-chlorophenoxy)-5-nitroanilino]ethene-1,1,2-tricarbonitrile |
|---|---|
| PubChem CID | 168608688 |
| Molecular Formula | C17H8ClN5O3 |
| Molecular Weight | 365.74 g/mol |
| Exact Mass | 365.03 |
| IUPAC Name | 2-[3-(4-chlorophenoxy)-5-nitroanilino]ethene-1,1,2-tricarbonitrile |
| SMILES | N#CC(C#N)=C(C#N)Nc1cc(Oc2ccc(Cl)cc2)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H8ClN5O3/c18-12-1-3-15(4-2-12)26-16-6-13(5-14(7-16)23(24)25)22-17(10-21)11(8-19)9-20/h1-7,22H |
| InChIKey | IOLNBYRURIGJPU-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 135.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.74 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|