C17H12ClN7O3 — CID 169345025
3-[3-(2-chloro-6-methylphenoxy)-5-nitroanilino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile (PubChem CID 169345025) has the molecular formula C17H12ClN7O3 and a molecular weight of 397.78 g/mol. Its IUPAC name is 3-[3-(2-chloro-6-methylphenoxy)-5-nitroanilino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile.
| Compound Name | 3-[3-(2-chloro-6-methylphenoxy)-5-nitroanilino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 169345025 |
| Molecular Formula | C17H12ClN7O3 |
| Molecular Weight | 397.78 g/mol |
| Exact Mass | 397.07 |
| IUPAC Name | 3-[3-(2-chloro-6-methylphenoxy)-5-nitroanilino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile |
| SMILES | Cc1cccc(Cl)c1Oc1cc(NC=C(C#N)c2nn[nH]n2)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H12ClN7O3/c1-10-3-2-4-15(18)16(10)28-14-6-12(5-13(7-14)25(26)27)20-9-11(8-19)17-21-23-24-22-17/h2-7,9,20H,1H3,(H,21,22,23,24) |
| InChIKey | FQZBKDMSABZQRQ-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 142.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.78 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|