C16H11ClN6O — CID 169342917
3-[4-(3-chlorophenoxy)anilino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile (PubChem CID 169342917) has the molecular formula C16H11ClN6O and a molecular weight of 338.76 g/mol. Its IUPAC name is 3-[4-(3-chlorophenoxy)anilino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile.
| Compound Name | 3-[4-(3-chlorophenoxy)anilino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 169342917 |
| Molecular Formula | C16H11ClN6O |
| Molecular Weight | 338.76 g/mol |
| Exact Mass | 338.07 |
| IUPAC Name | 3-[4-(3-chlorophenoxy)anilino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile |
| SMILES | N#CC(=CNc1ccc(Oc2cccc(Cl)c2)cc1)c1nn[nH]n1 |
| InChI | InChI=1S/C16H11ClN6O/c17-12-2-1-3-15(8-12)24-14-6-4-13(5-7-14)19-10-11(9-18)16-20-22-23-21-16/h1-8,10,19H,(H,20,21,22,23) |
| InChIKey | JLBCXIVTQFGXIL-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 99.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.76 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|