C17H11Cl2N7O — CID 169344301
2,4-dichloro-N-[3-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]phenyl]benzamide (PubChem CID 169344301) has the molecular formula C17H11Cl2N7O and a molecular weight of 400.23 g/mol. Its IUPAC name is 2,4-dichloro-N-[3-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]phenyl]benzamide.
| Compound Name | 2,4-dichloro-N-[3-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]phenyl]benzamide |
|---|---|
| PubChem CID | 169344301 |
| Molecular Formula | C17H11Cl2N7O |
| Molecular Weight | 400.23 g/mol |
| Exact Mass | 399.04 |
| IUPAC Name | 2,4-dichloro-N-[3-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]phenyl]benzamide |
| SMILES | N#CC(=CNc1cccc(NC(=O)c2ccc(Cl)cc2Cl)c1)c1nn[nH]n1 |
| InChI | InChI=1S/C17H11Cl2N7O/c18-11-4-5-14(15(19)6-11)17(27)22-13-3-1-2-12(7-13)21-9-10(8-20)16-23-25-26-24-16/h1-7,9,21H,(H,22,27)(H,23,24,25,26) |
| InChIKey | XDFAMOUBUBHYQP-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 119.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.23 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|