C15H11N7O2 — CID 169343785
N-[3-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]phenyl]furan-2-carboxamide (PubChem CID 169343785) has the molecular formula C15H11N7O2 and a molecular weight of 321.30 g/mol. Its IUPAC name is N-[3-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]phenyl]furan-2-carboxamide.
| Compound Name | N-[3-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 169343785 |
| Molecular Formula | C15H11N7O2 |
| Molecular Weight | 321.30 g/mol |
| Exact Mass | 321.10 |
| IUPAC Name | N-[3-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]phenyl]furan-2-carboxamide |
| SMILES | N#CC(=CNc1cccc(NC(=O)c2ccco2)c1)c1nn[nH]n1 |
| InChI | InChI=1S/C15H11N7O2/c16-8-10(14-19-21-22-20-14)9-17-11-3-1-4-12(7-11)18-15(23)13-5-2-6-24-13/h1-7,9,17H,(H,18,23)(H,19,20,21,22) |
| InChIKey | NASHWHDTLMSXPF-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 132.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.30 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|