C12H10N10 — CID 169343159
3-[3-(2-methyltetrazol-5-yl)anilino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile (PubChem CID 169343159) has the molecular formula C12H10N10 and a molecular weight of 294.28 g/mol. Its IUPAC name is 3-[3-(2-methyltetrazol-5-yl)anilino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile.
| Compound Name | 3-[3-(2-methyltetrazol-5-yl)anilino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 169343159 |
| Molecular Formula | C12H10N10 |
| Molecular Weight | 294.28 g/mol |
| Exact Mass | 294.11 |
| IUPAC Name | 3-[3-(2-methyltetrazol-5-yl)anilino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile |
| SMILES | Cn1nnc(-c2cccc(NC=C(C#N)c3nn[nH]n3)c2)n1 |
| InChI | InChI=1S/C12H10N10/c1-22-18-12(17-21-22)8-3-2-4-10(5-8)14-7-9(6-13)11-15-19-20-16-11/h2-5,7,14H,1H3,(H,15,16,19,20) |
| InChIKey | YNTAQUWBKFQLSP-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 133.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.28 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|