C13H8F4N4O3 — CID 168541403
2-[[3-nitro-5-(2,2,3,3-tetrafluoropropoxy)anilino]methylidene]propanedinitrile (PubChem CID 168541403) has the molecular formula C13H8F4N4O3 and a molecular weight of 344.22 g/mol. Its IUPAC name is 2-[[3-nitro-5-(2,2,3,3-tetrafluoropropoxy)anilino]methylidene]propanedinitrile.
| Compound Name | 2-[[3-nitro-5-(2,2,3,3-tetrafluoropropoxy)anilino]methylidene]propanedinitrile |
|---|---|
| PubChem CID | 168541403 |
| Molecular Formula | C13H8F4N4O3 |
| Molecular Weight | 344.22 g/mol |
| Exact Mass | 344.05 |
| IUPAC Name | 2-[[3-nitro-5-(2,2,3,3-tetrafluoropropoxy)anilino]methylidene]propanedinitrile |
| SMILES | N#CC(C#N)=CNc1cc(OCC(F)(F)C(F)F)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C13H8F4N4O3/c14-12(15)13(16,17)7-24-11-2-9(1-10(3-11)21(22)23)20-6-8(4-18)5-19/h1-3,6,12,20H,7H2 |
| InChIKey | PJLFRTYTHKLXGV-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 111.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.22 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|