C17H12F7N3O3S — CID 19678332
1-[3-nitro-5-(2,2,3,3-tetrafluoropropoxy)phenyl]-3-[2-(trifluoromethyl)phenyl]thiourea (PubChem CID 19678332) has the molecular formula C17H12F7N3O3S and a molecular weight of 471.35 g/mol. Its IUPAC name is 1-[3-nitro-5-(2,2,3,3-tetrafluoropropoxy)phenyl]-3-[2-(trifluoromethyl)phenyl]thiourea.
| Compound Name | 1-[3-nitro-5-(2,2,3,3-tetrafluoropropoxy)phenyl]-3-[2-(trifluoromethyl)phenyl]thiourea |
|---|---|
| PubChem CID | 19678332 |
| Molecular Formula | C17H12F7N3O3S |
| Molecular Weight | 471.35 g/mol |
| Exact Mass | 471.05 |
| IUPAC Name | 1-[3-nitro-5-(2,2,3,3-tetrafluoropropoxy)phenyl]-3-[2-(trifluoromethyl)phenyl]thiourea |
| SMILES | O=[N+]([O-])c1cc(NC(=S)Nc2ccccc2C(F)(F)F)cc(OCC(F)(F)C(F)F)c1 |
| InChI | InChI=1S/C17H12F7N3O3S/c18-14(19)16(20,21)8-30-11-6-9(5-10(7-11)27(28)29)25-15(31)26-13-4-2-1-3-12(13)17(22,23)24/h1-7,14H,8H2,(H2,25,26,31) |
| InChIKey | ALNZKFGWXOQUHC-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 76.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.35 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|