C15H10Cl2F3N3O3S — CID 19678219
1-(2,5-dichlorophenyl)-3-[3-nitro-5-(2,2,2-trifluoroethoxy)phenyl]thiourea (PubChem CID 19678219) has the molecular formula C15H10Cl2F3N3O3S and a molecular weight of 440.23 g/mol. Its IUPAC name is 1-(2,5-dichlorophenyl)-3-[3-nitro-5-(2,2,2-trifluoroethoxy)phenyl]thiourea.
| Compound Name | 1-(2,5-dichlorophenyl)-3-[3-nitro-5-(2,2,2-trifluoroethoxy)phenyl]thiourea |
|---|---|
| PubChem CID | 19678219 |
| Molecular Formula | C15H10Cl2F3N3O3S |
| Molecular Weight | 440.23 g/mol |
| Exact Mass | 438.98 |
| IUPAC Name | 1-(2,5-dichlorophenyl)-3-[3-nitro-5-(2,2,2-trifluoroethoxy)phenyl]thiourea |
| SMILES | O=[N+]([O-])c1cc(NC(=S)Nc2cc(Cl)ccc2Cl)cc(OCC(F)(F)F)c1 |
| InChI | InChI=1S/C15H10Cl2F3N3O3S/c16-8-1-2-12(17)13(3-8)22-14(27)21-9-4-10(23(24)25)6-11(5-9)26-7-15(18,19)20/h1-6H,7H2,(H2,21,22,27) |
| InChIKey | ABWLNSZWWYZIOW-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 76.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.23 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|