C17H16F3N3O5S — CID 19678262
1-(3,5-dimethoxyphenyl)-3-[3-nitro-5-(2,2,2-trifluoroethoxy)phenyl]thiourea (PubChem CID 19678262) has the molecular formula C17H16F3N3O5S and a molecular weight of 431.39 g/mol. Its IUPAC name is 1-(3,5-dimethoxyphenyl)-3-[3-nitro-5-(2,2,2-trifluoroethoxy)phenyl]thiourea.
| Compound Name | 1-(3,5-dimethoxyphenyl)-3-[3-nitro-5-(2,2,2-trifluoroethoxy)phenyl]thiourea |
|---|---|
| PubChem CID | 19678262 |
| Molecular Formula | C17H16F3N3O5S |
| Molecular Weight | 431.39 g/mol |
| Exact Mass | 431.08 |
| IUPAC Name | 1-(3,5-dimethoxyphenyl)-3-[3-nitro-5-(2,2,2-trifluoroethoxy)phenyl]thiourea |
| SMILES | COc1cc(NC(=S)Nc2cc(OCC(F)(F)F)cc([N+](=O)[O-])c2)cc(OC)c1 |
| InChI | InChI=1S/C17H16F3N3O5S/c1-26-13-4-11(5-14(8-13)27-2)22-16(29)21-10-3-12(23(24)25)7-15(6-10)28-9-17(18,19)20/h3-8H,9H2,1-2H3,(H2,21,22,29) |
| InChIKey | NPFHWXXYKWEMOW-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 94.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.39 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|