C18H17F4N3O5S — CID 19678327
1-(2,5-dimethoxyphenyl)-3-[3-nitro-5-(2,2,3,3-tetrafluoropropoxy)phenyl]thiourea (PubChem CID 19678327) has the molecular formula C18H17F4N3O5S and a molecular weight of 463.41 g/mol. Its IUPAC name is 1-(2,5-dimethoxyphenyl)-3-[3-nitro-5-(2,2,3,3-tetrafluoropropoxy)phenyl]thiourea.
| Compound Name | 1-(2,5-dimethoxyphenyl)-3-[3-nitro-5-(2,2,3,3-tetrafluoropropoxy)phenyl]thiourea |
|---|---|
| PubChem CID | 19678327 |
| Molecular Formula | C18H17F4N3O5S |
| Molecular Weight | 463.41 g/mol |
| Exact Mass | 463.08 |
| IUPAC Name | 1-(2,5-dimethoxyphenyl)-3-[3-nitro-5-(2,2,3,3-tetrafluoropropoxy)phenyl]thiourea |
| SMILES | COc1ccc(OC)c(NC(=S)Nc2cc(OCC(F)(F)C(F)F)cc([N+](=O)[O-])c2)c1 |
| InChI | InChI=1S/C18H17F4N3O5S/c1-28-12-3-4-15(29-2)14(8-12)24-17(31)23-10-5-11(25(26)27)7-13(6-10)30-9-18(21,22)16(19)20/h3-8,16H,9H2,1-2H3,(H2,23,24,31) |
| InChIKey | RMOROXGOOGHYIG-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 94.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.41 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|