C23H19F4N3O5S2 — CID 19678377
methyl 5-benzyl-2-[[3-nitro-5-(2,2,3,3-tetrafluoropropoxy)phenyl]carbamothioylamino]thiophene-3-carboxylate (PubChem CID 19678377) has the molecular formula C23H19F4N3O5S2 and a molecular weight of 557.55 g/mol. Its IUPAC name is methyl 5-benzyl-2-[[3-nitro-5-(2,2,3,3-tetrafluoropropoxy)phenyl]carbamothioylamino]thiophene-3-carboxylate.
| Compound Name | methyl 5-benzyl-2-[[3-nitro-5-(2,2,3,3-tetrafluoropropoxy)phenyl]carbamothioylamino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 19678377 |
| Molecular Formula | C23H19F4N3O5S2 |
| Molecular Weight | 557.55 g/mol |
| Exact Mass | 557.07 |
| IUPAC Name | methyl 5-benzyl-2-[[3-nitro-5-(2,2,3,3-tetrafluoropropoxy)phenyl]carbamothioylamino]thiophene-3-carboxylate |
| SMILES | COC(=O)c1cc(Cc2ccccc2)sc1NC(=S)Nc1cc(OCC(F)(F)C(F)F)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C23H19F4N3O5S2/c1-34-20(31)18-11-17(7-13-5-3-2-4-6-13)37-19(18)29-22(36)28-14-8-15(30(32)33)10-16(9-14)35-12-23(26,27)21(24)25/h2-6,8-11,21H,7,12H2,1H3,(H2,28,29,36) |
| InChIKey | GWTHROGMHWYJDL-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 102.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.55 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|