C22H18F3N3O4S2 — CID 19687594
ethyl 5-benzyl-2-[[4-nitro-2-(trifluoromethyl)phenyl]carbamothioylamino]thiophene-3-carboxylate (PubChem CID 19687594) has the molecular formula C22H18F3N3O4S2 and a molecular weight of 509.53 g/mol. Its IUPAC name is ethyl 5-benzyl-2-[[4-nitro-2-(trifluoromethyl)phenyl]carbamothioylamino]thiophene-3-carboxylate.
| Compound Name | ethyl 5-benzyl-2-[[4-nitro-2-(trifluoromethyl)phenyl]carbamothioylamino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 19687594 |
| Molecular Formula | C22H18F3N3O4S2 |
| Molecular Weight | 509.53 g/mol |
| Exact Mass | 509.07 |
| IUPAC Name | ethyl 5-benzyl-2-[[4-nitro-2-(trifluoromethyl)phenyl]carbamothioylamino]thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1cc(Cc2ccccc2)sc1NC(=S)Nc1ccc([N+](=O)[O-])cc1C(F)(F)F |
| InChI | InChI=1S/C22H18F3N3O4S2/c1-2-32-20(29)16-12-15(10-13-6-4-3-5-7-13)34-19(16)27-21(33)26-18-9-8-14(28(30)31)11-17(18)22(23,24)25/h3-9,11-12H,2,10H2,1H3,(H2,26,27,33) |
| InChIKey | INDYGWPYQOHMRX-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 93.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.53 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|