C28H27N3O4S3 — CID 19678796
ethyl 5-benzyl-2-[[4-[(2-methylphenyl)sulfamoyl]phenyl]carbamothioylamino]thiophene-3-carboxylate (PubChem CID 19678796) has the molecular formula C28H27N3O4S3 and a molecular weight of 565.74 g/mol. Its IUPAC name is ethyl 5-benzyl-2-[[4-[(2-methylphenyl)sulfamoyl]phenyl]carbamothioylamino]thiophene-3-carboxylate.
| Compound Name | ethyl 5-benzyl-2-[[4-[(2-methylphenyl)sulfamoyl]phenyl]carbamothioylamino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 19678796 |
| Molecular Formula | C28H27N3O4S3 |
| Molecular Weight | 565.74 g/mol |
| Exact Mass | 565.12 |
| IUPAC Name | ethyl 5-benzyl-2-[[4-[(2-methylphenyl)sulfamoyl]phenyl]carbamothioylamino]thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1cc(Cc2ccccc2)sc1NC(=S)Nc1ccc(S(=O)(=O)Nc2ccccc2C)cc1 |
| InChI | InChI=1S/C28H27N3O4S3/c1-3-35-27(32)24-18-22(17-20-10-5-4-6-11-20)37-26(24)30-28(36)29-21-13-15-23(16-14-21)38(33,34)31-25-12-8-7-9-19(25)2/h4-16,18,31H,3,17H2,1-2H3,(H2,29,30,36) |
| InChIKey | DTPWAEXZCACMFA-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.74 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|