C20H26N4O2S2 — CID 2957701
ethyl 5-benzyl-2-[(4-methylpiperazin-1-yl)carbamothioylamino]thiophene-3-carboxylate (PubChem CID 2957701) has the molecular formula C20H26N4O2S2 and a molecular weight of 418.59 g/mol. Its IUPAC name is ethyl 5-benzyl-2-[(4-methylpiperazin-1-yl)carbamothioylamino]thiophene-3-carboxylate.
| Compound Name | ethyl 5-benzyl-2-[(4-methylpiperazin-1-yl)carbamothioylamino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 2957701 |
| Molecular Formula | C20H26N4O2S2 |
| Molecular Weight | 418.59 g/mol |
| Exact Mass | 418.15 |
| IUPAC Name | ethyl 5-benzyl-2-[(4-methylpiperazin-1-yl)carbamothioylamino]thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1cc(Cc2ccccc2)sc1NC(=S)NN1CCN(C)CC1 |
| InChI | InChI=1S/C20H26N4O2S2/c1-3-26-19(25)17-14-16(13-15-7-5-4-6-8-15)28-18(17)21-20(27)22-24-11-9-23(2)10-12-24/h4-8,14H,3,9-13H2,1-2H3,(H2,21,22,27) |
| InChIKey | HLFKHSNLLAPKBK-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.59 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|