C21H26N2O3S2 — CID 2204968
ethyl 5-benzyl-2-[[(1R)-1-[(2R)-oxolan-2-yl]ethyl]carbamothioylamino]thiophene-3-carboxylate (PubChem CID 2204968) has the molecular formula C21H26N2O3S2 and a molecular weight of 418.58 g/mol. Its IUPAC name is ethyl 5-benzyl-2-[[(1R)-1-[(2R)-oxolan-2-yl]ethyl]carbamothioylamino]thiophene-3-carboxylate.
| Compound Name | ethyl 5-benzyl-2-[[(1R)-1-[(2R)-oxolan-2-yl]ethyl]carbamothioylamino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 2204968 |
| Molecular Formula | C21H26N2O3S2 |
| Molecular Weight | 418.58 g/mol |
| Exact Mass | 418.14 |
| IUPAC Name | ethyl 5-benzyl-2-[[(1R)-1-[(2R)-oxolan-2-yl]ethyl]carbamothioylamino]thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1cc(Cc2ccccc2)sc1NC(=S)N[C@H](C)[C@H]1CCCO1 |
| InChI | InChI=1S/C21H26N2O3S2/c1-3-25-20(24)17-13-16(12-15-8-5-4-6-9-15)28-19(17)23-21(27)22-14(2)18-10-7-11-26-18/h4-6,8-9,13-14,18H,3,7,10-12H2,1-2H3,(H2,22,23,27)/t14-,18-/m1/s1 |
| InChIKey | COSQLYREEZIMGC-RDTXWAMCSA-N |
| XLogP | 4.37 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.58 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|